C20H20N4O6 — CID 97182765
ethyl (2R,4S)-6-methyl-2,4-bis(3-nitrophenyl)-1,2,3,4-tetrahydropyrimidine-5-carboxylate (PubChem CID 97182765) has the molecular formula C20H20N4O6 and a molecular weight of 412.40 g/mol. Its IUPAC name is ethyl (2R,4S)-6-methyl-2,4-bis(3-nitrophenyl)-1,2,3,4-tetrahydropyrimidine-5-carboxylate.
| Compound Name | ethyl (2R,4S)-6-methyl-2,4-bis(3-nitrophenyl)-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 97182765 |
| Molecular Formula | C20H20N4O6 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | ethyl (2R,4S)-6-methyl-2,4-bis(3-nitrophenyl)-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N[C@H](c2cccc([N+](=O)[O-])c2)N[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20N4O6/c1-3-30-20(25)17-12(2)21-19(14-7-5-9-16(11-14)24(28)29)22-18(17)13-6-4-8-15(10-13)23(26)27/h4-11,18-19,21-22H,3H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | LYSZPSRFMMSDIP-OALUTQOASA-N |
| XLogP | 3.27 |
| TPSA | 136.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|