C21H27N3O2+2 — CID 11888517
(1R,4aR)-2-benzyl-1-(4-nitrophenyl)-1,2,3,4,4a,5,6,7,8,9-decahydropyrido[1,2-c]pyrimidine-2,9-diium (PubChem CID 11888517) has the molecular formula C21H27N3O2+2 and a molecular weight of 353.47 g/mol. Its IUPAC name is (1R,4aR)-2-benzyl-1-(4-nitrophenyl)-1,2,3,4,4a,5,6,7,8,9-decahydropyrido[1,2-c]pyrimidine-2,9-diium.
| Compound Name | (1R,4aR)-2-benzyl-1-(4-nitrophenyl)-1,2,3,4,4a,5,6,7,8,9-decahydropyrido[1,2-c]pyrimidine-2,9-diium |
|---|---|
| PubChem CID | 11888517 |
| Molecular Formula | C21H27N3O2+2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | (1R,4aR)-2-benzyl-1-(4-nitrophenyl)-1,2,3,4,4a,5,6,7,8,9-decahydropyrido[1,2-c]pyrimidine-2,9-diium |
| SMILES | O=[N+]([O-])c1ccc([C@@H]2[NH+](Cc3ccccc3)CC[C@H]3CCCC[NH+]32)cc1 |
| InChI | InChI=1S/C21H25N3O2/c25-24(26)20-11-9-18(10-12-20)21-22(16-17-6-2-1-3-7-17)15-13-19-8-4-5-14-23(19)21/h1-3,6-7,9-12,19,21H,4-5,8,13-16H2/p+2/t19-,21-/m1/s1 |
| InChIKey | CPSBVMNHKZOJSO-TZIWHRDSSA-P |
| XLogP | 1.52 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|