C13H16N+ — CID 11863579
(1R,4S)-2-benzyl-2-azoniabicyclo[2.2.1]hept-5-ene (PubChem CID 11863579) has the molecular formula C13H16N+ and a molecular weight of 186.28 g/mol. Its IUPAC name is (1R,4S)-2-benzyl-2-azoniabicyclo[2.2.1]hept-5-ene.
| Compound Name | (1R,4S)-2-benzyl-2-azoniabicyclo[2.2.1]hept-5-ene |
|---|---|
| PubChem CID | 11863579 |
| Molecular Formula | C13H16N+ |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (1R,4S)-2-benzyl-2-azoniabicyclo[2.2.1]hept-5-ene |
| SMILES | C1=C[C@H]2C[C@@H]1C[NH+]2Cc1ccccc1 |
| InChI | InChI=1S/C13H15N/c1-2-4-11(5-3-1)9-14-10-12-6-7-13(14)8-12/h1-7,12-13H,8-10H2/p+1/t12-,13+/m1/s1 |
| InChIKey | LXICLGVNNWLLTE-OLZOCXBDSA-O |
| XLogP | 1.03 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|