C27H28N2O+2 — CID 6967391
1-(1,3-dibenzylimidazolidine-1,3-diium-2-yl)naphthalen-2-ol (PubChem CID 6967391) has the molecular formula C27H28N2O+2 and a molecular weight of 396.53 g/mol. Its IUPAC name is 1-(1,3-dibenzylimidazolidine-1,3-diium-2-yl)naphthalen-2-ol.
| Compound Name | 1-(1,3-dibenzylimidazolidine-1,3-diium-2-yl)naphthalen-2-ol |
|---|---|
| PubChem CID | 6967391 |
| Molecular Formula | C27H28N2O+2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 1-(1,3-dibenzylimidazolidine-1,3-diium-2-yl)naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1C1[NH+](Cc2ccccc2)CC[NH+]1Cc1ccccc1 |
| InChI | InChI=1S/C27H26N2O/c30-25-16-15-23-13-7-8-14-24(23)26(25)27-28(19-21-9-3-1-4-10-21)17-18-29(27)20-22-11-5-2-6-12-22/h1-16,27,30H,17-20H2/p+2 |
| InChIKey | ZIUFOEDEFZZIGM-UHFFFAOYSA-P |
| XLogP | 2.73 |
| TPSA | 29.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|