C36H44N2O2+2 — CID 7897158
1,5-bis[(4-benzylpiperidin-1-ium-1-yl)methyl]naphthalene-2,6-diol (PubChem CID 7897158) has the molecular formula C36H44N2O2+2 and a molecular weight of 536.76 g/mol. Its IUPAC name is 1,5-bis[(4-benzylpiperidin-1-ium-1-yl)methyl]naphthalene-2,6-diol.
| Compound Name | 1,5-bis[(4-benzylpiperidin-1-ium-1-yl)methyl]naphthalene-2,6-diol |
|---|---|
| PubChem CID | 7897158 |
| Molecular Formula | C36H44N2O2+2 |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | 1,5-bis[(4-benzylpiperidin-1-ium-1-yl)methyl]naphthalene-2,6-diol |
| SMILES | Oc1ccc2c(C[NH+]3CCC(Cc4ccccc4)CC3)c(O)ccc2c1C[NH+]1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C36H42N2O2/c39-35-13-12-32-31(33(35)25-37-19-15-29(16-20-37)23-27-7-3-1-4-8-27)11-14-36(40)34(32)26-38-21-17-30(18-22-38)24-28-9-5-2-6-10-28/h1-14,29-30,39-40H,15-26H2/p+2 |
| InChIKey | CIDRHJBDPDXZHH-UHFFFAOYSA-P |
| XLogP | 4.33 |
| TPSA | 49.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|