C14H21N2O+ — CID 40636152
2-(4-benzylpiperidin-1-ium-1-yl)acetamide (PubChem CID 40636152) has the molecular formula C14H21N2O+ and a molecular weight of 233.34 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-ium-1-yl)acetamide.
| Compound Name | 2-(4-benzylpiperidin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 40636152 |
| Molecular Formula | C14H21N2O+ |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 2-(4-benzylpiperidin-1-ium-1-yl)acetamide |
| SMILES | NC(=O)C[NH+]1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C14H20N2O/c15-14(17)11-16-8-6-13(7-9-16)10-12-4-2-1-3-5-12/h1-5,13H,6-11H2,(H2,15,17)/p+1 |
| InChIKey | BTJVFOMLHDYBGE-UHFFFAOYSA-O |
| XLogP | 0.01 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |