C25H34N3O2+ — CID 8904524
2-(4-benzylpiperidin-1-ium-1-yl)-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylacetamide (PubChem CID 8904524) has the molecular formula C25H34N3O2+ and a molecular weight of 408.57 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-ium-1-yl)-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylacetamide.
| Compound Name | 2-(4-benzylpiperidin-1-ium-1-yl)-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 8904524 |
| Molecular Formula | C25H34N3O2+ |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 2-(4-benzylpiperidin-1-ium-1-yl)-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylacetamide |
| SMILES | CCc1ccccc1NC(=O)CN(C)C(=O)C[NH+]1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H33N3O2/c1-3-22-11-7-8-12-23(22)26-24(29)18-27(2)25(30)19-28-15-13-21(14-16-28)17-20-9-5-4-6-10-20/h4-12,21H,3,13-19H2,1-2H3,(H,26,29)/p+1 |
| InChIKey | DZWJYIHXRTYLGI-UHFFFAOYSA-O |
| XLogP | 2.18 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |