C23H31N4O2+ — CID 8688394
N-[2-(2-ethylanilino)-2-oxoethyl]-N-methyl-2-(4-phenylpiperazin-1-ium-1-yl)acetamide (PubChem CID 8688394) has the molecular formula C23H31N4O2+ and a molecular weight of 395.53 g/mol. Its IUPAC name is N-[2-(2-ethylanilino)-2-oxoethyl]-N-methyl-2-(4-phenylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-[2-(2-ethylanilino)-2-oxoethyl]-N-methyl-2-(4-phenylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8688394 |
| Molecular Formula | C23H31N4O2+ |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | N-[2-(2-ethylanilino)-2-oxoethyl]-N-methyl-2-(4-phenylpiperazin-1-ium-1-yl)acetamide |
| SMILES | CCc1ccccc1NC(=O)CN(C)C(=O)C[NH+]1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N4O2/c1-3-19-9-7-8-12-21(19)24-22(28)17-25(2)23(29)18-26-13-15-27(16-14-26)20-10-5-4-6-11-20/h4-12H,3,13-18H2,1-2H3,(H,24,28)/p+1 |
| InChIKey | IZYCJVVVYCKACI-UHFFFAOYSA-O |
| XLogP | 1.05 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |