C22H36N4O2+2 — CID 8773211
2-[4-[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-(2-ethylphenyl)acetamide (PubChem CID 8773211) has the molecular formula C22H36N4O2+2 and a molecular weight of 388.56 g/mol. Its IUPAC name is 2-[4-[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[4-[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 8773211 |
| Molecular Formula | C22H36N4O2+2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | 2-[4-[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-(2-ethylphenyl)acetamide |
| SMILES | C=C(C)CN(CC)C(=O)C[NH+]1CC[NH+](CC(=O)Nc2ccccc2CC)CC1 |
| InChI | InChI=1S/C22H34N4O2/c1-5-19-9-7-8-10-20(19)23-21(27)16-24-11-13-25(14-12-24)17-22(28)26(6-2)15-18(3)4/h7-10H,3,5-6,11-17H2,1-2,4H3,(H,23,27)/p+2 |
| InChIKey | QZOCISVSMWJVFE-UHFFFAOYSA-P |
| XLogP | -0.60 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|