C20H23Cl2N2O+ — CID 7430136
2-(4-benzylpiperidin-1-ium-1-yl)-N-(2,3-dichlorophenyl)acetamide (PubChem CID 7430136) has the molecular formula C20H23Cl2N2O+ and a molecular weight of 378.32 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-ium-1-yl)-N-(2,3-dichlorophenyl)acetamide.
| Compound Name | 2-(4-benzylpiperidin-1-ium-1-yl)-N-(2,3-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 7430136 |
| Molecular Formula | C20H23Cl2N2O+ |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 2-(4-benzylpiperidin-1-ium-1-yl)-N-(2,3-dichlorophenyl)acetamide |
| SMILES | O=C(C[NH+]1CCC(Cc2ccccc2)CC1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C20H22Cl2N2O/c21-17-7-4-8-18(20(17)22)23-19(25)14-24-11-9-16(10-12-24)13-15-5-2-1-3-6-15/h1-8,16H,9-14H2,(H,23,25)/p+1 |
| InChIKey | ZJRFUZOOHJNRSO-UHFFFAOYSA-O |
| XLogP | 3.47 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |