C22H30N5O+ — CID 8542830
1-(4-benzylpiperidin-1-yl)-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)ethanone (PubChem CID 8542830) has the molecular formula C22H30N5O+ and a molecular weight of 380.52 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)ethanone.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 8542830 |
| Molecular Formula | C22H30N5O+ |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)ethanone |
| SMILES | O=C(C[NH+]1CCN(c2ncccn2)CC1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H29N5O/c28-21(18-25-13-15-27(16-14-25)22-23-9-4-10-24-22)26-11-7-20(8-12-26)17-19-5-2-1-3-6-19/h1-6,9-10,20H,7-8,11-18H2/p+1 |
| InChIKey | WWZZWQQDYLCURQ-UHFFFAOYSA-O |
| XLogP | 0.66 |
| TPSA | 53.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |