C19H22Cl2N+ — CID 7375018
4-benzyl-1-[(3,4-dichlorophenyl)methyl]piperidin-1-ium (PubChem CID 7375018) has the molecular formula C19H22Cl2N+ and a molecular weight of 335.30 g/mol. Its IUPAC name is 4-benzyl-1-[(3,4-dichlorophenyl)methyl]piperidin-1-ium.
| Compound Name | 4-benzyl-1-[(3,4-dichlorophenyl)methyl]piperidin-1-ium |
|---|---|
| PubChem CID | 7375018 |
| Molecular Formula | C19H22Cl2N+ |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 4-benzyl-1-[(3,4-dichlorophenyl)methyl]piperidin-1-ium |
| SMILES | Clc1ccc(C[NH+]2CCC(Cc3ccccc3)CC2)cc1Cl |
| InChI | InChI=1S/C19H21Cl2N/c20-18-7-6-17(13-19(18)21)14-22-10-8-16(9-11-22)12-15-4-2-1-3-5-15/h1-7,13,16H,8-12,14H2/p+1 |
| InChIKey | LAPZKXYCKQBJME-UHFFFAOYSA-O |
| XLogP | 4.03 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |