C13H20Cl2N2O+2 — CID 6944829
2-[4-[(3,4-dichlorophenyl)methyl]piperazine-1,4-diium-1-yl]ethanol (PubChem CID 6944829) has the molecular formula C13H20Cl2N2O+2 and a molecular weight of 291.22 g/mol. Its IUPAC name is 2-[4-[(3,4-dichlorophenyl)methyl]piperazine-1,4-diium-1-yl]ethanol.
| Compound Name | 2-[4-[(3,4-dichlorophenyl)methyl]piperazine-1,4-diium-1-yl]ethanol |
|---|---|
| PubChem CID | 6944829 |
| Molecular Formula | C13H20Cl2N2O+2 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-[4-[(3,4-dichlorophenyl)methyl]piperazine-1,4-diium-1-yl]ethanol |
| SMILES | OCC[NH+]1CC[NH+](Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H18Cl2N2O/c14-12-2-1-11(9-13(12)15)10-17-5-3-16(4-6-17)7-8-18/h1-2,9,18H,3-8,10H2/p+2 |
| InChIKey | JRKBQBSPMUTJNV-UHFFFAOYSA-P |
| XLogP | -0.73 |
| TPSA | 29.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |