C14H19Cl2N2O2+ — CID 6942868
ethyl 4-[(3,4-dichlorophenyl)methyl]piperazin-4-ium-1-carboxylate (PubChem CID 6942868) has the molecular formula C14H19Cl2N2O2+ and a molecular weight of 318.22 g/mol. Its IUPAC name is ethyl 4-[(3,4-dichlorophenyl)methyl]piperazin-4-ium-1-carboxylate.
| Compound Name | ethyl 4-[(3,4-dichlorophenyl)methyl]piperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 6942868 |
| Molecular Formula | C14H19Cl2N2O2+ |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | ethyl 4-[(3,4-dichlorophenyl)methyl]piperazin-4-ium-1-carboxylate |
| SMILES | CCOC(=O)N1CC[NH+](Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H18Cl2N2O2/c1-2-20-14(19)18-7-5-17(6-8-18)10-11-3-4-12(15)13(16)9-11/h3-4,9H,2,5-8,10H2,1H3/p+1 |
| InChIKey | LRQYTNSTQVWUOX-UHFFFAOYSA-O |
| XLogP | 1.85 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |