C19H29N4O3+ — CID 7316418
ethyl 4-[1-(pyridin-3-ylmethyl)piperidin-1-ium-4-carbonyl]piperazine-1-carboxylate (PubChem CID 7316418) has the molecular formula C19H29N4O3+ and a molecular weight of 361.47 g/mol. Its IUPAC name is ethyl 4-[1-(pyridin-3-ylmethyl)piperidin-1-ium-4-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[1-(pyridin-3-ylmethyl)piperidin-1-ium-4-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 7316418 |
| Molecular Formula | C19H29N4O3+ |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | ethyl 4-[1-(pyridin-3-ylmethyl)piperidin-1-ium-4-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C2CC[NH+](Cc3cccnc3)CC2)CC1 |
| InChI | InChI=1S/C19H28N4O3/c1-2-26-19(25)23-12-10-22(11-13-23)18(24)17-5-8-21(9-6-17)15-16-4-3-7-20-14-16/h3-4,7,14,17H,2,5-6,8-13,15H2,1H3/p+1 |
| InChIKey | LQAHXLGNUWWHNR-UHFFFAOYSA-O |
| XLogP | 0.18 |
| TPSA | 67.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |