C19H28N4O4 — CID 113122149
ethyl 4-[acetyl-[3-oxo-3-(pyridin-3-ylmethylamino)propyl]amino]piperidine-1-carboxylate (PubChem CID 113122149) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is ethyl 4-[acetyl-[3-oxo-3-(pyridin-3-ylmethylamino)propyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[acetyl-[3-oxo-3-(pyridin-3-ylmethylamino)propyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113122149 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | ethyl 4-[acetyl-[3-oxo-3-(pyridin-3-ylmethylamino)propyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N(CCC(=O)NCc2cccnc2)C(C)=O)CC1 |
| InChI | InChI=1S/C19H28N4O4/c1-3-27-19(26)22-10-6-17(7-11-22)23(15(2)24)12-8-18(25)21-14-16-5-4-9-20-13-16/h4-5,9,13,17H,3,6-8,10-12,14H2,1-2H3,(H,21,25) |
| InChIKey | AOBASXPDENCKNS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |