C15H22N4O3 — CID 110706271
ethyl 4-(pyridin-3-ylmethylcarbamoylamino)piperidine-1-carboxylate (PubChem CID 110706271) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is ethyl 4-(pyridin-3-ylmethylcarbamoylamino)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(pyridin-3-ylmethylcarbamoylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110706271 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | ethyl 4-(pyridin-3-ylmethylcarbamoylamino)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)NCc2cccnc2)CC1 |
| InChI | InChI=1S/C15H22N4O3/c1-2-22-15(21)19-8-5-13(6-9-19)18-14(20)17-11-12-4-3-7-16-10-12/h3-4,7,10,13H,2,5-6,8-9,11H2,1H3,(H2,17,18,20) |
| InChIKey | KYMKDKJKLSNFAK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |