C19H24N6O3 — CID 109121105
ethyl 4-[[6-(pyridin-3-ylmethylcarbamoyl)pyridazin-3-yl]amino]piperidine-1-carboxylate (PubChem CID 109121105) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is ethyl 4-[[6-(pyridin-3-ylmethylcarbamoyl)pyridazin-3-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[6-(pyridin-3-ylmethylcarbamoyl)pyridazin-3-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109121105 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | ethyl 4-[[6-(pyridin-3-ylmethylcarbamoyl)pyridazin-3-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ccc(C(=O)NCc3cccnc3)nn2)CC1 |
| InChI | InChI=1S/C19H24N6O3/c1-2-28-19(27)25-10-7-15(8-11-25)22-17-6-5-16(23-24-17)18(26)21-13-14-4-3-9-20-12-14/h3-6,9,12,15H,2,7-8,10-11,13H2,1H3,(H,21,26)(H,22,24) |
| InChIKey | LKCXJQGHYSCSFJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |