C16H23N3O3 — CID 31369357
ethyl 4-(3-pyridin-3-ylpropanoylamino)piperidine-1-carboxylate (PubChem CID 31369357) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is ethyl 4-(3-pyridin-3-ylpropanoylamino)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(3-pyridin-3-ylpropanoylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 31369357 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | ethyl 4-(3-pyridin-3-ylpropanoylamino)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CCc2cccnc2)CC1 |
| InChI | InChI=1S/C16H23N3O3/c1-2-22-16(21)19-10-7-14(8-11-19)18-15(20)6-5-13-4-3-9-17-12-13/h3-4,9,12,14H,2,5-8,10-11H2,1H3,(H,18,20) |
| InChIKey | HFQBOHYSPHNUCN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |