C11H14N2O3 — CID 110465393
ethyl 3-oxo-3-(pyridin-3-ylmethylamino)propanoate (PubChem CID 110465393) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is ethyl 3-oxo-3-(pyridin-3-ylmethylamino)propanoate.
| Compound Name | ethyl 3-oxo-3-(pyridin-3-ylmethylamino)propanoate |
|---|---|
| PubChem CID | 110465393 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | ethyl 3-oxo-3-(pyridin-3-ylmethylamino)propanoate |
| SMILES | CCOC(=O)CC(=O)NCc1cccnc1 |
| InChI | InChI=1S/C11H14N2O3/c1-2-16-11(15)6-10(14)13-8-9-4-3-5-12-7-9/h3-5,7H,2,6,8H2,1H3,(H,13,14) |
| InChIKey | ARQACVQHCRODKK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|