C18H28N6O3 — CID 159498879
ethyl 3-pyridin-3-ylpropanoate;hydrazine;3-pyridin-3-ylpropanehydrazide (PubChem CID 159498879) has the molecular formula C18H28N6O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is ethyl 3-pyridin-3-ylpropanoate;hydrazine;3-pyridin-3-ylpropanehydrazide.
| Compound Name | ethyl 3-pyridin-3-ylpropanoate;hydrazine;3-pyridin-3-ylpropanehydrazide |
|---|---|
| PubChem CID | 159498879 |
| Molecular Formula | C18H28N6O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | ethyl 3-pyridin-3-ylpropanoate;hydrazine;3-pyridin-3-ylpropanehydrazide |
| SMILES | CCOC(=O)CCc1cccnc1.NN.NNC(=O)CCc1cccnc1 |
| InChI | InChI=1S/C10H13NO2.C8H11N3O.H4N2/c1-2-13-10(12)6-5-9-4-3-7-11-8-9;9-11-8(12)4-3-7-2-1-5-10-6-7;1-2/h3-4,7-8H,2,5-6H2,1H3;1-2,5-6H,3-4,9H2,(H,11,12);1-2H2 |
| InChIKey | LZDBBFVFLPALRI-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 159.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|