C24H32N2O3 — CID 19711405
ethyl 3-[3-[2-(3-methylbutanoylamino)ethyl]-5-(pyridin-3-ylmethyl)phenyl]propanoate (PubChem CID 19711405) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is ethyl 3-[3-[2-(3-methylbutanoylamino)ethyl]-5-(pyridin-3-ylmethyl)phenyl]propanoate.
| Compound Name | ethyl 3-[3-[2-(3-methylbutanoylamino)ethyl]-5-(pyridin-3-ylmethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 19711405 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | ethyl 3-[3-[2-(3-methylbutanoylamino)ethyl]-5-(pyridin-3-ylmethyl)phenyl]propanoate |
| SMILES | CCOC(=O)CCc1cc(CCNC(=O)CC(C)C)cc(Cc2cccnc2)c1 |
| InChI | InChI=1S/C24H32N2O3/c1-4-29-24(28)8-7-19-13-20(9-11-26-23(27)12-18(2)3)15-22(14-19)16-21-6-5-10-25-17-21/h5-6,10,13-15,17-18H,4,7-9,11-12,16H2,1-3H3,(H,26,27) |
| InChIKey | CLQVOAPWABMGPY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |