C26H28N2O3 — CID 10645577
ethyl 3-[3-(2-benzamidoethyl)-5-(pyridin-3-ylmethyl)phenyl]propanoate (PubChem CID 10645577) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is ethyl 3-[3-(2-benzamidoethyl)-5-(pyridin-3-ylmethyl)phenyl]propanoate.
| Compound Name | ethyl 3-[3-(2-benzamidoethyl)-5-(pyridin-3-ylmethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 10645577 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | ethyl 3-[3-(2-benzamidoethyl)-5-(pyridin-3-ylmethyl)phenyl]propanoate |
| SMILES | CCOC(=O)CCc1cc(CCNC(=O)c2ccccc2)cc(Cc2cccnc2)c1 |
| InChI | InChI=1S/C26H28N2O3/c1-2-31-25(29)11-10-20-15-21(12-14-28-26(30)24-8-4-3-5-9-24)17-23(16-20)18-22-7-6-13-27-19-22/h3-9,13,15-17,19H,2,10-12,14,18H2,1H3,(H,28,30) |
| InChIKey | YVXOJZXQZDDOEC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |