C19H23ClN2O4S — CID 10669297
ethyl 3-[3-[2-(chlorosulfonylamino)ethyl]-5-(pyridin-3-ylmethyl)phenyl]propanoate (PubChem CID 10669297) has the molecular formula C19H23ClN2O4S and a molecular weight of 410.92 g/mol. Its IUPAC name is ethyl 3-[3-[2-(chlorosulfonylamino)ethyl]-5-(pyridin-3-ylmethyl)phenyl]propanoate.
| Compound Name | ethyl 3-[3-[2-(chlorosulfonylamino)ethyl]-5-(pyridin-3-ylmethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 10669297 |
| Molecular Formula | C19H23ClN2O4S |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | ethyl 3-[3-[2-(chlorosulfonylamino)ethyl]-5-(pyridin-3-ylmethyl)phenyl]propanoate |
| SMILES | CCOC(=O)CCc1cc(CCNS(=O)(=O)Cl)cc(Cc2cccnc2)c1 |
| InChI | InChI=1S/C19H23ClN2O4S/c1-2-26-19(23)6-5-15-10-16(7-9-22-27(20,24)25)12-18(11-15)13-17-4-3-8-21-14-17/h3-4,8,10-12,14,22H,2,5-7,9,13H2,1H3 |
| InChIKey | HFMYTDOKSYQQIF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |