C23H32N2O4S — CID 67671033
ethyl 3-[3-[4-(propylsulfonylamino)-1-pyridin-3-ylbutan-2-yl]phenyl]propanoate (PubChem CID 67671033) has the molecular formula C23H32N2O4S and a molecular weight of 432.59 g/mol. Its IUPAC name is ethyl 3-[3-[4-(propylsulfonylamino)-1-pyridin-3-ylbutan-2-yl]phenyl]propanoate.
| Compound Name | ethyl 3-[3-[4-(propylsulfonylamino)-1-pyridin-3-ylbutan-2-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 67671033 |
| Molecular Formula | C23H32N2O4S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | ethyl 3-[3-[4-(propylsulfonylamino)-1-pyridin-3-ylbutan-2-yl]phenyl]propanoate |
| SMILES | CCCS(=O)(=O)NCCC(Cc1cccnc1)c1cccc(CCC(=O)OCC)c1 |
| InChI | InChI=1S/C23H32N2O4S/c1-3-15-30(27,28)25-14-12-22(17-20-8-6-13-24-18-20)21-9-5-7-19(16-21)10-11-23(26)29-4-2/h5-9,13,16,18,22,25H,3-4,10-12,14-15,17H2,1-2H3 |
| InChIKey | CFLRWUPKJRVOFU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |