C21H25NO5 — CID 67668126
3-[3-(3-ethoxy-3-oxopropyl)-5-(hydroxymethyl)-2-(pyridin-3-ylmethyl)phenyl]propanoic acid (PubChem CID 67668126) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is 3-[3-(3-ethoxy-3-oxopropyl)-5-(hydroxymethyl)-2-(pyridin-3-ylmethyl)phenyl]propanoic acid.
| Compound Name | 3-[3-(3-ethoxy-3-oxopropyl)-5-(hydroxymethyl)-2-(pyridin-3-ylmethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 67668126 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 3-[3-(3-ethoxy-3-oxopropyl)-5-(hydroxymethyl)-2-(pyridin-3-ylmethyl)phenyl]propanoic acid |
| SMILES | CCOC(=O)CCc1cc(CO)cc(CCC(=O)O)c1Cc1cccnc1 |
| InChI | InChI=1S/C21H25NO5/c1-2-27-21(26)8-6-18-11-16(14-23)10-17(5-7-20(24)25)19(18)12-15-4-3-9-22-13-15/h3-4,9-11,13,23H,2,5-8,12,14H2,1H3,(H,24,25) |
| InChIKey | VFFBZTNHAOKDEV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |