C7H5BrCl2Zn — CID 67230004
4-(bromomethyl)-1,2-dichlorobenzene;zinc (PubChem CID 67230004) has the molecular formula C7H5BrCl2Zn and a molecular weight of 305.32 g/mol. Its IUPAC name is 4-(bromomethyl)-1,2-dichlorobenzene;zinc.
| Compound Name | 4-(bromomethyl)-1,2-dichlorobenzene;zinc |
|---|---|
| PubChem CID | 67230004 |
| Molecular Formula | C7H5BrCl2Zn |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 301.82 |
| IUPAC Name | 4-(bromomethyl)-1,2-dichlorobenzene;zinc |
| SMILES | Clc1ccc(CBr)cc1Cl.[Zn] |
| InChI | InChI=1S/C7H5BrCl2.Zn/c8-4-5-1-2-6(9)7(10)3-5;/h1-3H,4H2; |
| InChIKey | ZCVMZNMJVWSUOH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|