C20H13BrCl2O — CID 19043698
[4-[4-(bromomethyl)phenyl]phenyl]-(3,4-dichlorophenyl)methanone (PubChem CID 19043698) has the molecular formula C20H13BrCl2O and a molecular weight of 420.13 g/mol. Its IUPAC name is [4-[4-(bromomethyl)phenyl]phenyl]-(3,4-dichlorophenyl)methanone.
| Compound Name | [4-[4-(bromomethyl)phenyl]phenyl]-(3,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 19043698 |
| Molecular Formula | C20H13BrCl2O |
| Molecular Weight | 420.13 g/mol |
| Exact Mass | 417.95 |
| IUPAC Name | [4-[4-(bromomethyl)phenyl]phenyl]-(3,4-dichlorophenyl)methanone |
| SMILES | O=C(c1ccc(-c2ccc(CBr)cc2)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H13BrCl2O/c21-12-13-1-3-14(4-2-13)15-5-7-16(8-6-15)20(24)17-9-10-18(22)19(23)11-17/h1-11H,12H2 |
| InChIKey | FLAJEHZOIBLCHA-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.13 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|