C12H8Cl2O2 — CID 43463771
(3,4-dichlorophenyl)-(5-methylfuran-2-yl)methanone (PubChem CID 43463771) has the molecular formula C12H8Cl2O2 and a molecular weight of 255.10 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(5-methylfuran-2-yl)methanone.
| Compound Name | (3,4-dichlorophenyl)-(5-methylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 43463771 |
| Molecular Formula | C12H8Cl2O2 |
| Molecular Weight | 255.10 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | (3,4-dichlorophenyl)-(5-methylfuran-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C12H8Cl2O2/c1-7-2-5-11(16-7)12(15)8-3-4-9(13)10(14)6-8/h2-6H,1H3 |
| InChIKey | HTXOBFBLFHGBTD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.10 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |