C13H9Cl2NO — CID 141087497
4-(3,4-dichlorophenyl)benzamide (PubChem CID 141087497) has the molecular formula C13H9Cl2NO and a molecular weight of 266.13 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)benzamide.
| Compound Name | 4-(3,4-dichlorophenyl)benzamide |
|---|---|
| PubChem CID | 141087497 |
| Molecular Formula | C13H9Cl2NO |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 4-(3,4-dichlorophenyl)benzamide |
| SMILES | NC(=O)c1ccc(-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C13H9Cl2NO/c14-11-6-5-10(7-12(11)15)8-1-3-9(4-2-8)13(16)17/h1-7H,(H2,16,17) |
| InChIKey | DWRIVWCDGAGDGM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |