C13H8Cl2FNO — CID 134623243
5-(3,4-dichlorophenyl)-2-fluorobenzamide (PubChem CID 134623243) has the molecular formula C13H8Cl2FNO and a molecular weight of 284.12 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-2-fluorobenzamide.
| Compound Name | 5-(3,4-dichlorophenyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 134623243 |
| Molecular Formula | C13H8Cl2FNO |
| Molecular Weight | 284.12 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-2-fluorobenzamide |
| SMILES | NC(=O)c1cc(-c2ccc(Cl)c(Cl)c2)ccc1F |
| InChI | InChI=1S/C13H8Cl2FNO/c14-10-3-1-8(6-11(10)15)7-2-4-12(16)9(5-7)13(17)18/h1-6H,(H2,17,18) |
| InChIKey | ZCXXDTHEVGYYII-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.12 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |