C14H10ClFN2O2 — CID 152528464
2-(3-chloro-4-fluorophenyl)benzene-1,3-dicarboxamide (PubChem CID 152528464) has the molecular formula C14H10ClFN2O2 and a molecular weight of 292.70 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)benzene-1,3-dicarboxamide.
| Compound Name | 2-(3-chloro-4-fluorophenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 152528464 |
| Molecular Formula | C14H10ClFN2O2 |
| Molecular Weight | 292.70 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)benzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cccc(C(N)=O)c1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H10ClFN2O2/c15-10-6-7(4-5-11(10)16)12-8(13(17)19)2-1-3-9(12)14(18)20/h1-6H,(H2,17,19)(H2,18,20) |
| InChIKey | YJAITRAVLXZDMV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.70 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |