C13H9Cl2FN2O3S — CID 39331681
5-[(3,4-dichlorophenyl)sulfonylamino]-2-fluorobenzamide (PubChem CID 39331681) has the molecular formula C13H9Cl2FN2O3S and a molecular weight of 363.20 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)sulfonylamino]-2-fluorobenzamide.
| Compound Name | 5-[(3,4-dichlorophenyl)sulfonylamino]-2-fluorobenzamide |
|---|---|
| PubChem CID | 39331681 |
| Molecular Formula | C13H9Cl2FN2O3S |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)sulfonylamino]-2-fluorobenzamide |
| SMILES | NC(=O)c1cc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)ccc1F |
| InChI | InChI=1S/C13H9Cl2FN2O3S/c14-10-3-2-8(6-11(10)15)22(20,21)18-7-1-4-12(16)9(5-7)13(17)19/h1-6,18H,(H2,17,19) |
| InChIKey | JDWDRVQGXDXIHO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |