C12H6BrCl2NO — CID 43167215
(5-bromo-3-pyridinyl)-(3,4-dichlorophenyl)methanone (PubChem CID 43167215) has the molecular formula C12H6BrCl2NO and a molecular weight of 331.00 g/mol. Its IUPAC name is (5-bromo-3-pyridinyl)-(3,4-dichlorophenyl)methanone.
| Compound Name | (5-bromo-3-pyridinyl)-(3,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 43167215 |
| Molecular Formula | C12H6BrCl2NO |
| Molecular Weight | 331.00 g/mol |
| Exact Mass | 328.90 |
| IUPAC Name | (5-bromo-3-pyridinyl)-(3,4-dichlorophenyl)methanone |
| SMILES | O=C(c1cncc(Br)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H6BrCl2NO/c13-9-3-8(5-16-6-9)12(17)7-1-2-10(14)11(15)4-7/h1-6H |
| InChIKey | BWWBFCHQVPRMBD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.00 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |