C13H20Cl2N2+2 — CID 6940212
1-[(3,4-dichlorophenyl)methyl]-4-methyl-1,4-diazepane-1,4-diium (PubChem CID 6940212) has the molecular formula C13H20Cl2N2+2 and a molecular weight of 275.22 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-4-methyl-1,4-diazepane-1,4-diium.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-4-methyl-1,4-diazepane-1,4-diium |
|---|---|
| PubChem CID | 6940212 |
| Molecular Formula | C13H20Cl2N2+2 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-4-methyl-1,4-diazepane-1,4-diium |
| SMILES | C[NH+]1CCC[NH+](Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H18Cl2N2/c1-16-5-2-6-17(8-7-16)10-11-3-4-12(14)13(15)9-11/h3-4,9H,2,5-8,10H2,1H3/p+2 |
| InChIKey | YSOHJVUYIHLGFD-UHFFFAOYSA-P |
| XLogP | 0.30 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |