C25H27NO4 — CID 139184240
(3aS,4S,7R,7aR)-5-benzyl-4-(2-hydroxynaphthalen-1-yl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-ol (PubChem CID 139184240) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is (3aS,4S,7R,7aR)-5-benzyl-4-(2-hydroxynaphthalen-1-yl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-ol.
| Compound Name | (3aS,4S,7R,7aR)-5-benzyl-4-(2-hydroxynaphthalen-1-yl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-ol |
|---|---|
| PubChem CID | 139184240 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | (3aS,4S,7R,7aR)-5-benzyl-4-(2-hydroxynaphthalen-1-yl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-ol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H](O)CN(Cc1ccccc1)[C@H]2c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C25H27NO4/c1-25(2)29-23-20(28)15-26(14-16-8-4-3-5-9-16)22(24(23)30-25)21-18-11-7-6-10-17(18)12-13-19(21)27/h3-13,20,22-24,27-28H,14-15H2,1-2H3/t20-,22+,23-,24+/m1/s1 |
| InChIKey | QCBXMJVGEBAPNC-ONTLXTELSA-N |
| XLogP | 3.98 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|