C16H21NO4 — CID 139206220
(1S,2R,6S,7S,8R)-10-benzyl-4,4-dimethyl-3,5,9-trioxa-10-azatricyclo[6.2.1.02,6]undecan-7-ol (PubChem CID 139206220) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is (1S,2R,6S,7S,8R)-10-benzyl-4,4-dimethyl-3,5,9-trioxa-10-azatricyclo[6.2.1.02,6]undecan-7-ol.
| Compound Name | (1S,2R,6S,7S,8R)-10-benzyl-4,4-dimethyl-3,5,9-trioxa-10-azatricyclo[6.2.1.02,6]undecan-7-ol |
|---|---|
| PubChem CID | 139206220 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | (1S,2R,6S,7S,8R)-10-benzyl-4,4-dimethyl-3,5,9-trioxa-10-azatricyclo[6.2.1.02,6]undecan-7-ol |
| SMILES | CC1(C)O[C@H]2[C@H](O)[C@H]3C[C@@H]([C@H]2O1)N(Cc1ccccc1)O3 |
| InChI | InChI=1S/C16H21NO4/c1-16(2)19-14-11-8-12(13(18)15(14)20-16)21-17(11)9-10-6-4-3-5-7-10/h3-7,11-15,18H,8-9H2,1-2H3/t11-,12+,13+,14+,15-/m0/s1 |
| InChIKey | YOPLPFUPLVYPIU-JARUQAPTSA-N |
| XLogP | 1.46 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |