C31H33NO6 — CID 102157033
[(1R,2R,3S,7R,8S,9S)-11-benzyl-5,5-dimethyl-2-phenylmethoxy-4,6,10-trioxa-11-azatricyclo[7.2.1.03,7]dodecan-8-yl] benzoate (PubChem CID 102157033) has the molecular formula C31H33NO6 and a molecular weight of 515.61 g/mol. Its IUPAC name is [(1R,2R,3S,7R,8S,9S)-11-benzyl-5,5-dimethyl-2-phenylmethoxy-4,6,10-trioxa-11-azatricyclo[7.2.1.03,7]dodecan-8-yl] benzoate.
| Compound Name | [(1R,2R,3S,7R,8S,9S)-11-benzyl-5,5-dimethyl-2-phenylmethoxy-4,6,10-trioxa-11-azatricyclo[7.2.1.03,7]dodecan-8-yl] benzoate |
|---|---|
| PubChem CID | 102157033 |
| Molecular Formula | C31H33NO6 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | [(1R,2R,3S,7R,8S,9S)-11-benzyl-5,5-dimethyl-2-phenylmethoxy-4,6,10-trioxa-11-azatricyclo[7.2.1.03,7]dodecan-8-yl] benzoate |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@H](OCc1ccccc1)[C@H]1C[C@H](ON1Cc1ccccc1)[C@H]2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H33NO6/c1-31(2)36-28-26(34-20-22-14-8-4-9-15-22)24-18-25(38-32(24)19-21-12-6-3-7-13-21)27(29(28)37-31)35-30(33)23-16-10-5-11-17-23/h3-17,24-29H,18-20H2,1-2H3/t24-,25+,26-,27-,28+,29+/m1/s1 |
| InChIKey | TZGKLWZGZWMWKI-HOQNYSLDSA-N |
| XLogP | 4.91 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |