C25H30N2O5 — CID 118461036
[(3aR,4S,6R,7R,7aR)-5-benzyl-2,2,6-trimethyl-4-(methylcarbamoyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-yl] benzoate (PubChem CID 118461036) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is [(3aR,4S,6R,7R,7aR)-5-benzyl-2,2,6-trimethyl-4-(methylcarbamoyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-yl] benzoate.
| Compound Name | [(3aR,4S,6R,7R,7aR)-5-benzyl-2,2,6-trimethyl-4-(methylcarbamoyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-yl] benzoate |
|---|---|
| PubChem CID | 118461036 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | [(3aR,4S,6R,7R,7aR)-5-benzyl-2,2,6-trimethyl-4-(methylcarbamoyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-yl] benzoate |
| SMILES | CNC(=O)[C@@H]1[C@H]2OC(C)(C)O[C@H]2[C@H](OC(=O)c2ccccc2)[C@@H](C)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H30N2O5/c1-16-20(30-24(29)18-13-9-6-10-14-18)22-21(31-25(2,3)32-22)19(23(28)26-4)27(16)15-17-11-7-5-8-12-17/h5-14,16,19-22H,15H2,1-4H3,(H,26,28)/t16-,19+,20-,21-,22+/m1/s1 |
| InChIKey | CYHJQEFYUCOHAR-CLMCDVRKSA-N |
| XLogP | 2.75 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |