C17H23FN2O3 — CID 123908325
5-benzyl-7-fluoro-N,2,2-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-4-carboxamide (PubChem CID 123908325) has the molecular formula C17H23FN2O3 and a molecular weight of 322.38 g/mol. Its IUPAC name is 5-benzyl-7-fluoro-N,2,2-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-4-carboxamide.
| Compound Name | 5-benzyl-7-fluoro-N,2,2-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 123908325 |
| Molecular Formula | C17H23FN2O3 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 5-benzyl-7-fluoro-N,2,2-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-4-carboxamide |
| SMILES | CNC(=O)C1C2OC(C)(C)OC2C(F)CN1Cc1ccccc1 |
| InChI | InChI=1S/C17H23FN2O3/c1-17(2)22-14-12(18)10-20(9-11-7-5-4-6-8-11)13(15(14)23-17)16(21)19-3/h4-8,12-15H,9-10H2,1-3H3,(H,19,21) |
| InChIKey | CHOHMGVXSRAKKK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |