C15H20F2N2O — CID 118459844
(2R,3R,4S,5R)-1-benzyl-3,4-difluoro-N,5-dimethylpiperidine-2-carboxamide (PubChem CID 118459844) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is (2R,3R,4S,5R)-1-benzyl-3,4-difluoro-N,5-dimethylpiperidine-2-carboxamide.
| Compound Name | (2R,3R,4S,5R)-1-benzyl-3,4-difluoro-N,5-dimethylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 118459844 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (2R,3R,4S,5R)-1-benzyl-3,4-difluoro-N,5-dimethylpiperidine-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1[C@@H](F)[C@@H](F)[C@H](C)CN1Cc1ccccc1 |
| InChI | InChI=1S/C15H20F2N2O/c1-10-8-19(9-11-6-4-3-5-7-11)14(15(20)18-2)13(17)12(10)16/h3-7,10,12-14H,8-9H2,1-2H3,(H,18,20)/t10-,12+,13+,14+/m1/s1 |
| InChIKey | WWDSXJJVXZNDGK-SAXRGWBVSA-N |
| XLogP | 1.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |