C24H29NO5 — CID 102157043
(1S,2R,3S,7S,8R,9R)-11-benzyl-5,5-dimethyl-2-phenylmethoxy-4,6,10-trioxa-11-azatricyclo[7.2.1.03,7]dodecan-8-ol (PubChem CID 102157043) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is (1S,2R,3S,7S,8R,9R)-11-benzyl-5,5-dimethyl-2-phenylmethoxy-4,6,10-trioxa-11-azatricyclo[7.2.1.03,7]dodecan-8-ol.
| Compound Name | (1S,2R,3S,7S,8R,9R)-11-benzyl-5,5-dimethyl-2-phenylmethoxy-4,6,10-trioxa-11-azatricyclo[7.2.1.03,7]dodecan-8-ol |
|---|---|
| PubChem CID | 102157043 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | (1S,2R,3S,7S,8R,9R)-11-benzyl-5,5-dimethyl-2-phenylmethoxy-4,6,10-trioxa-11-azatricyclo[7.2.1.03,7]dodecan-8-ol |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@@H](O)[C@H]1C[C@@H]([C@H]2OCc2ccccc2)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C24H29NO5/c1-24(2)28-22-20(26)19-13-18(25(30-19)14-16-9-5-3-6-10-16)21(23(22)29-24)27-15-17-11-7-4-8-12-17/h3-12,18-23,26H,13-15H2,1-2H3/t18-,19+,20-,21+,22-,23-/m0/s1 |
| InChIKey | KDNVGNPBKUTQOS-NVNANWAMSA-N |
| XLogP | 3.04 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |