C24H26O6S — CID 10623070
(1R,2S,3S,7R,8S,9R)-11,11-dimethyl-2,8-bis(phenylmethoxy)-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-5-thione (PubChem CID 10623070) has the molecular formula C24H26O6S and a molecular weight of 442.53 g/mol. Its IUPAC name is (1R,2S,3S,7R,8S,9R)-11,11-dimethyl-2,8-bis(phenylmethoxy)-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-5-thione.
| Compound Name | (1R,2S,3S,7R,8S,9R)-11,11-dimethyl-2,8-bis(phenylmethoxy)-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-5-thione |
|---|---|
| PubChem CID | 10623070 |
| Molecular Formula | C24H26O6S |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | (1R,2S,3S,7R,8S,9R)-11,11-dimethyl-2,8-bis(phenylmethoxy)-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-5-thione |
| SMILES | CC1(C)O[C@@H]2[C@H](OCc3ccccc3)[C@H]3OC(=S)O[C@H]3[C@@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C24H26O6S/c1-24(2)29-21-17(25-13-15-9-5-3-6-10-15)19-20(28-23(31)27-19)18(22(21)30-24)26-14-16-11-7-4-8-12-16/h3-12,17-22H,13-14H2,1-2H3/t17-,18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | XBJXLHRNZNDCGA-WHVWYTALSA-N |
| XLogP | 3.76 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|