C31H42O9 — CID 101198831
(1R,15R,16R,17R,21S,22R)-19,19-dimethyl-16,22-bis(phenylmethoxy)-2,5,8,11,14,18,20-heptaoxatricyclo[13.7.0.017,21]docosane (PubChem CID 101198831) has the molecular formula C31H42O9 and a molecular weight of 558.67 g/mol. Its IUPAC name is (1R,15R,16R,17R,21S,22R)-19,19-dimethyl-16,22-bis(phenylmethoxy)-2,5,8,11,14,18,20-heptaoxatricyclo[13.7.0.017,21]docosane.
| Compound Name | (1R,15R,16R,17R,21S,22R)-19,19-dimethyl-16,22-bis(phenylmethoxy)-2,5,8,11,14,18,20-heptaoxatricyclo[13.7.0.017,21]docosane |
|---|---|
| PubChem CID | 101198831 |
| Molecular Formula | C31H42O9 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | (1R,15R,16R,17R,21S,22R)-19,19-dimethyl-16,22-bis(phenylmethoxy)-2,5,8,11,14,18,20-heptaoxatricyclo[13.7.0.017,21]docosane |
| SMILES | CC1(C)O[C@@H]2[C@H](OCc3ccccc3)[C@H]3OCCOCCOCCOCCO[C@@H]3[C@@H](OCc3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C31H42O9/c1-31(2)39-29-27(37-21-23-9-5-3-6-10-23)25-26(28(30(29)40-31)38-22-24-11-7-4-8-12-24)36-20-18-34-16-14-32-13-15-33-17-19-35-25/h3-12,25-30H,13-22H2,1-2H3/t25-,26-,27+,28+,29-,30+/m0/s1 |
| InChIKey | JHPXVJHEPOAPGU-XBSCKGQLSA-N |
| XLogP | 3.52 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |