C17H22O5 — CID 11023166
(1S,2S,4R,5R,6S,7R)-5-methoxy-9,9-dimethyl-6-phenylmethoxy-3,8,10-trioxatricyclo[5.3.0.02,4]decane (PubChem CID 11023166) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is (1S,2S,4R,5R,6S,7R)-5-methoxy-9,9-dimethyl-6-phenylmethoxy-3,8,10-trioxatricyclo[5.3.0.02,4]decane.
| Compound Name | (1S,2S,4R,5R,6S,7R)-5-methoxy-9,9-dimethyl-6-phenylmethoxy-3,8,10-trioxatricyclo[5.3.0.02,4]decane |
|---|---|
| PubChem CID | 11023166 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (1S,2S,4R,5R,6S,7R)-5-methoxy-9,9-dimethyl-6-phenylmethoxy-3,8,10-trioxatricyclo[5.3.0.02,4]decane |
| SMILES | CO[C@@H]1[C@H](OCc2ccccc2)[C@H]2OC(C)(C)O[C@H]2[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C17H22O5/c1-17(2)21-15-12(19-9-10-7-5-4-6-8-10)11(18-3)13-14(20-13)16(15)22-17/h4-8,11-16H,9H2,1-3H3/t11-,12+,13+,14+,15-,16+/m1/s1 |
| InChIKey | ZZHASLDNVLVIDV-GWNLFYIMSA-N |
| XLogP | 1.89 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|