C16H20O5 — CID 101127715
(1R,2S,4S,5R,8R)-10,10-dimethyl-5-phenylmethoxy-3,7,9,11-tetraoxatricyclo[6.3.0.02,4]undecane (PubChem CID 101127715) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is (1R,2S,4S,5R,8R)-10,10-dimethyl-5-phenylmethoxy-3,7,9,11-tetraoxatricyclo[6.3.0.02,4]undecane.
| Compound Name | (1R,2S,4S,5R,8R)-10,10-dimethyl-5-phenylmethoxy-3,7,9,11-tetraoxatricyclo[6.3.0.02,4]undecane |
|---|---|
| PubChem CID | 101127715 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (1R,2S,4S,5R,8R)-10,10-dimethyl-5-phenylmethoxy-3,7,9,11-tetraoxatricyclo[6.3.0.02,4]undecane |
| SMILES | CC1(C)O[C@H]2OC[C@@H](OCc3ccccc3)[C@@H]3O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C16H20O5/c1-16(2)20-14-13-12(19-13)11(9-18-15(14)21-16)17-8-10-6-4-3-5-7-10/h3-7,11-15H,8-9H2,1-2H3/t11-,12+,13+,14-,15-/m1/s1 |
| InChIKey | OLAWYHSMPDTSAN-GZBLMMOJSA-N |
| XLogP | 1.85 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|