C27H27NO3 — CID 122367297
(3aS,4S,7R,7aR)-5-benzyl-2,2-dimethyl-4-(2-naphthalen-1-ylethynyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-ol (PubChem CID 122367297) has the molecular formula C27H27NO3 and a molecular weight of 413.52 g/mol. Its IUPAC name is (3aS,4S,7R,7aR)-5-benzyl-2,2-dimethyl-4-(2-naphthalen-1-ylethynyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-ol.
| Compound Name | (3aS,4S,7R,7aR)-5-benzyl-2,2-dimethyl-4-(2-naphthalen-1-ylethynyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-ol |
|---|---|
| PubChem CID | 122367297 |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (3aS,4S,7R,7aR)-5-benzyl-2,2-dimethyl-4-(2-naphthalen-1-ylethynyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-ol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H](O)CN(Cc1ccccc1)[C@H]2C#Cc1cccc2ccccc12 |
| InChI | InChI=1S/C27H27NO3/c1-27(2)30-25-23(16-15-21-13-8-12-20-11-6-7-14-22(20)21)28(18-24(29)26(25)31-27)17-19-9-4-3-5-10-19/h3-14,23-26,29H,17-18H2,1-2H3/t23-,24+,25-,26+/m0/s1 |
| InChIKey | CMZYJVXFBFWBLE-ROXDYWFKSA-N |
| XLogP | 3.96 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|