C15H26N2+2 — CID 7175875
benzyl-[(2S,4R,5R)-1,2,5-trimethylpiperidin-1-ium-4-yl]azanium (PubChem CID 7175875) has the molecular formula C15H26N2+2 and a molecular weight of 234.39 g/mol. Its IUPAC name is benzyl-[(2S,4R,5R)-1,2,5-trimethylpiperidin-1-ium-4-yl]azanium.
| Compound Name | benzyl-[(2S,4R,5R)-1,2,5-trimethylpiperidin-1-ium-4-yl]azanium |
|---|---|
| PubChem CID | 7175875 |
| Molecular Formula | C15H26N2+2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | benzyl-[(2S,4R,5R)-1,2,5-trimethylpiperidin-1-ium-4-yl]azanium |
| SMILES | C[C@@H]1C[NH+](C)[C@@H](C)C[C@H]1[NH2+]Cc1ccccc1 |
| InChI | InChI=1S/C15H24N2/c1-12-11-17(3)13(2)9-15(12)16-10-14-7-5-4-6-8-14/h4-8,12-13,15-16H,9-11H2,1-3H3/p+2/t12-,13+,15-/m1/s1 |
| InChIKey | WSVFANOWQHGVOH-VNHYZAJKSA-P |
| XLogP | 0.06 |
| TPSA | 21.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |