C17H20NO2S+ — CID 7138766
benzyl-[(3R,4S)-1,1-dioxo-4-phenylthiolan-3-yl]azanium (PubChem CID 7138766) has the molecular formula C17H20NO2S+ and a molecular weight of 302.42 g/mol. Its IUPAC name is benzyl-[(3R,4S)-1,1-dioxo-4-phenylthiolan-3-yl]azanium.
| Compound Name | benzyl-[(3R,4S)-1,1-dioxo-4-phenylthiolan-3-yl]azanium |
|---|---|
| PubChem CID | 7138766 |
| Molecular Formula | C17H20NO2S+ |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | benzyl-[(3R,4S)-1,1-dioxo-4-phenylthiolan-3-yl]azanium |
| SMILES | O=S1(=O)C[C@H]([NH2+]Cc2ccccc2)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C17H19NO2S/c19-21(20)12-16(15-9-5-2-6-10-15)17(13-21)18-11-14-7-3-1-4-8-14/h1-10,16-18H,11-13H2/p+1/t16-,17-/m0/s1 |
| InChIKey | VMIVEXMISUDXGH-IRXDYDNUSA-O |
| XLogP | 1.33 |
| TPSA | 50.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |