C20H24O6S — CID 10500723
(3S,4R,5R,6S)-1,1-dioxo-4,5-bis(phenylmethoxy)thiepane-3,6-diol (PubChem CID 10500723) has the molecular formula C20H24O6S and a molecular weight of 392.47 g/mol. Its IUPAC name is (3S,4R,5R,6S)-1,1-dioxo-4,5-bis(phenylmethoxy)thiepane-3,6-diol.
| Compound Name | (3S,4R,5R,6S)-1,1-dioxo-4,5-bis(phenylmethoxy)thiepane-3,6-diol |
|---|---|
| PubChem CID | 10500723 |
| Molecular Formula | C20H24O6S |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | (3S,4R,5R,6S)-1,1-dioxo-4,5-bis(phenylmethoxy)thiepane-3,6-diol |
| SMILES | O=S1(=O)C[C@@H](O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](O)C1 |
| InChI | InChI=1S/C20H24O6S/c21-17-13-27(23,24)14-18(22)20(26-12-16-9-5-2-6-10-16)19(17)25-11-15-7-3-1-4-8-15/h1-10,17-22H,11-14H2/t17-,18-,19-,20-/m1/s1 |
| InChIKey | HMVUCYRTWLDVBS-UAFMIMERSA-N |
| XLogP | 1.31 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |